C13H18N2O3 — CID 91035324
[(3S,4S)-4-hydroxypyrrolidin-3-yl]methyl N-benzylcarbamate (PubChem CID 91035324) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is [(3S,4S)-4-hydroxypyrrolidin-3-yl]methyl N-benzylcarbamate.
| Compound Name | [(3S,4S)-4-hydroxypyrrolidin-3-yl]methyl N-benzylcarbamate |
|---|---|
| PubChem CID | 91035324 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | [(3S,4S)-4-hydroxypyrrolidin-3-yl]methyl N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)OC[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C13H18N2O3/c16-12-8-14-7-11(12)9-18-13(17)15-6-10-4-2-1-3-5-10/h1-5,11-12,14,16H,6-9H2,(H,15,17)/t11-,12+/m0/s1 |
| InChIKey | SMOIPYPESCDCTA-NWDGAFQWSA-N |
| XLogP | 0.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |