C15H20O2 — CID 91035633
4-(6-methylhepta-3,5-dien-3-yloxy)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 91035633) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4-(6-methylhepta-3,5-dien-3-yloxy)cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 4-(6-methylhepta-3,5-dien-3-yloxy)cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 91035633 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 4-(6-methylhepta-3,5-dien-3-yloxy)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCC(=CC=C(C)C)OC1=CC=C(C=O)CC1 |
| InChI | InChI=1S/C15H20O2/c1-4-14(8-5-12(2)3)17-15-9-6-13(11-16)7-10-15/h5-6,8-9,11H,4,7,10H2,1-3H3 |
| InChIKey | DZIKEAQNXYTCOB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|