C10H8N2O3 — CID 91035756
[4-(1,2-oxazol-3-yl)phenyl]carbamic acid (PubChem CID 91035756) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is [4-(1,2-oxazol-3-yl)phenyl]carbamic acid.
| Compound Name | [4-(1,2-oxazol-3-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 91035756 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | [4-(1,2-oxazol-3-yl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C10H8N2O3/c13-10(14)11-8-3-1-7(2-4-8)9-5-6-15-12-9/h1-6,11H,(H,13,14) |
| InChIKey | UTGKQBSJQDODPL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |