[4-(1,2-oxazol-3-yl)phenyl]carbamic acid

C10H8N2O3 — CID 91035756

IUPAC[4-(1,2-oxazol-3-yl)phenyl]carbamic acid
SMILESO=C(O)Nc1ccc(-c2ccon2)cc1
InChIInChI=1S/C10H8N2O3/c13-10(14)11-8-3-1-7(2-4-8)9-5-6-15-12-9/h1-6,11H,(H,13,14)
InChIKeyUTGKQBSJQDODPL-UHFFFAOYSA-N
MW204.19 g/mol
LogP2.43
Rot. Bonds2

About [4-(1,2-oxazol-3-yl)phenyl]carbamic acid

[4-(1,2-oxazol-3-yl)phenyl]carbamic acid (PubChem CID 91035756) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is [4-(1,2-oxazol-3-yl)phenyl]carbamic acid.

Molecular Properties

Compound Name[4-(1,2-oxazol-3-yl)phenyl]carbamic acid
PubChem CID91035756
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Name[4-(1,2-oxazol-3-yl)phenyl]carbamic acid
SMILESO=C(O)Nc1ccc(-c2ccon2)cc1
InChIInChI=1S/C10H8N2O3/c13-10(14)11-8-3-1-7(2-4-8)9-5-6-15-12-9/h1-6,11H,(H,13,14)
InChIKeyUTGKQBSJQDODPL-UHFFFAOYSA-N
XLogP2.43
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 52.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze [4-(1,2-oxazol-3-yl)phenyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(1,2-oxazol-3-yl)phenyl]carbamic acid?
The IUPAC name of [4-(1,2-oxazol-3-yl)phenyl]carbamic acid (CID 91035756) is [4-(1,2-oxazol-3-yl)phenyl]carbamic acid.
What is the SMILES notation for [4-(1,2-oxazol-3-yl)phenyl]carbamic acid?
The canonical SMILES for [4-(1,2-oxazol-3-yl)phenyl]carbamic acid is O=C(O)Nc1ccc(-c2ccon2)cc1.
What is the InChIKey of [4-(1,2-oxazol-3-yl)phenyl]carbamic acid?
The InChIKey is UTGKQBSJQDODPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-10(14)11-8-3-1-7(2-4-8)9-5-6-15-12-9/h1-6,11H,(H,13,14).
What are the key properties of [4-(1,2-oxazol-3-yl)phenyl]carbamic acid?
[4-(1,2-oxazol-3-yl)phenyl]carbamic acid has a molecular weight of 204.19 g/mol, XLogP of 2.43, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2-oxazol-3-yl)phenyl]carbamic acid is sourced from PubChem (CID 91035756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).