C19H36N4O3 — CID 91037180
6-acetamido-N-(3-methylbutan-2-yl)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hex-3-enamide (PubChem CID 91037180) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 6-acetamido-N-(3-methylbutan-2-yl)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hex-3-enamide.
| Compound Name | 6-acetamido-N-(3-methylbutan-2-yl)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hex-3-enamide |
|---|---|
| PubChem CID | 91037180 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 6-acetamido-N-(3-methylbutan-2-yl)-2-[[3-methyl-2-(methylamino)butanoyl]amino]hex-3-enamide |
| SMILES | CNC(C(=O)NC(C=CCCNC(C)=O)C(=O)NC(C)C(C)C)C(C)C |
| InChI | InChI=1S/C19H36N4O3/c1-12(2)14(5)22-18(25)16(10-8-9-11-21-15(6)24)23-19(26)17(20-7)13(3)4/h8,10,12-14,16-17,20H,9,11H2,1-7H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | OZSZGNBBOUAOAB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|