C25H48NO2+ — CID 91040046
diethyl-methyl-(4,4,6,9,9-pentamethyl-11-prop-2-enoyloxydodec-6-en-2-yl)azanium (PubChem CID 91040046) has the molecular formula C25H48NO2+ and a molecular weight of 394.66 g/mol. Its IUPAC name is diethyl-methyl-(4,4,6,9,9-pentamethyl-11-prop-2-enoyloxydodec-6-en-2-yl)azanium.
| Compound Name | diethyl-methyl-(4,4,6,9,9-pentamethyl-11-prop-2-enoyloxydodec-6-en-2-yl)azanium |
|---|---|
| PubChem CID | 91040046 |
| Molecular Formula | C25H48NO2+ |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 394.37 |
| IUPAC Name | diethyl-methyl-(4,4,6,9,9-pentamethyl-11-prop-2-enoyloxydodec-6-en-2-yl)azanium |
| SMILES | C=CC(=O)OC(C)CC(C)(C)CC=C(C)CC(C)(C)CC(C)[N+](C)(CC)CC |
| InChI | InChI=1S/C25H48NO2/c1-12-23(27)28-22(6)19-24(7,8)16-15-20(4)17-25(9,10)18-21(5)26(11,13-2)14-3/h12,15,21-22H,1,13-14,16-19H2,2-11H3/q+1 |
| InChIKey | GCECZJISZGYACC-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|