C39H62O8 — CID 91041600
benzyl 2-methylbutanoate;2,3-dihydroxypropyl 2,2-dimethylbutanoate;4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,2-dimethylbutanoate (PubChem CID 91041600) has the molecular formula C39H62O8 and a molecular weight of 658.92 g/mol. Its IUPAC name is benzyl 2-methylbutanoate;2,3-dihydroxypropyl 2,2-dimethylbutanoate;4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,2-dimethylbutanoate.
| Compound Name | benzyl 2-methylbutanoate;2,3-dihydroxypropyl 2,2-dimethylbutanoate;4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91041600 |
| Molecular Formula | C39H62O8 |
| Molecular Weight | 658.92 g/mol |
| Exact Mass | 658.44 |
| IUPAC Name | benzyl 2-methylbutanoate;2,3-dihydroxypropyl 2,2-dimethylbutanoate;4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1C1C3CCC(C3)C21.CCC(C)(C)C(=O)OCC(O)CO.CCC(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H28O2.C12H16O2.C9H18O4/c1-4-18(2,3)17(19)20-14-9-12-8-13(14)16-11-6-5-10(7-11)15(12)16;1-3-10(2)12(13)14-9-11-7-5-4-6-8-11;1-4-9(2,3)8(12)13-6-7(11)5-10/h10-16H,4-9H2,1-3H3;4-8,10H,3,9H2,1-2H3;7,10-11H,4-6H2,1-3H3 |
| InChIKey | ULPIFQCYNNEFPV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.92 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|