C43H48F6O6 — CID 134461978
1-O-anthracen-2-yl 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 134461978) has the molecular formula C43H48F6O6 and a molecular weight of 774.84 g/mol. Its IUPAC name is 1-O-anthracen-2-yl 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 1-O-anthracen-2-yl 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134461978 |
| Molecular Formula | C43H48F6O6 |
| Molecular Weight | 774.84 g/mol |
| Exact Mass | 774.34 |
| IUPAC Name | 1-O-anthracen-2-yl 3-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(C)(CC(C)(CC(C)(C)C(=O)Oc1ccc2cc3ccccc3cc2c1)C(=O)OC1CC2CC1C1C3CCC(C3)C21)C(=O)OCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C43H48F6O6/c1-39(2,36(50)53-20-33(42(44,45)46)43(47,48)49)21-41(5,38(52)55-32-19-29-18-31(32)35-27-11-10-26(16-27)34(29)35)22-40(3,4)37(51)54-30-13-12-25-14-23-8-6-7-9-24(23)15-28(25)17-30/h6-9,12-15,17,26-27,29,31-35H,10-11,16,18-22H2,1-5H3 |
| InChIKey | GFWYYSOLOXYFRT-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.84 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|