C45H58O6 — CID 159487445
1-O-anthracen-2-yl 5-O-(2-methylpropyl) 3-O-(3-tetracyclo[7.3.1.11,4.05,13]tetradecanyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 159487445) has the molecular formula C45H58O6 and a molecular weight of 694.95 g/mol. Its IUPAC name is 1-O-anthracen-2-yl 5-O-(2-methylpropyl) 3-O-(3-tetracyclo[7.3.1.11,4.05,13]tetradecanyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 1-O-anthracen-2-yl 5-O-(2-methylpropyl) 3-O-(3-tetracyclo[7.3.1.11,4.05,13]tetradecanyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 159487445 |
| Molecular Formula | C45H58O6 |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 694.42 |
| IUPAC Name | 1-O-anthracen-2-yl 5-O-(2-methylpropyl) 3-O-(3-tetracyclo[7.3.1.11,4.05,13]tetradecanyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(C)COC(=O)C(C)(C)CC(C)(CC(C)(C)C(=O)Oc1ccc2cc3ccccc3cc2c1)C(=O)OC1CC23CCCC4CCCC(C1C2)C43 |
| InChI | InChI=1S/C45H58O6/c1-28(2)25-49-39(46)42(3,4)26-44(7,41(48)51-37-24-45-19-11-15-29-14-10-16-35(38(29)45)36(37)23-45)27-43(5,6)40(47)50-34-18-17-32-20-30-12-8-9-13-31(30)21-33(32)22-34/h8-9,12-13,17-18,20-22,28-29,35-38H,10-11,14-16,19,23-27H2,1-7H3 |
| InChIKey | VBPNAIBHYRTMOZ-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|