C19H22O6S — CID 168836459
3-(2,2-dimethyl-3-naphthalen-2-yloxy-3-oxopropyl)sulfanyl-4-hydroperoxybutanoic acid (PubChem CID 168836459) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3-naphthalen-2-yloxy-3-oxopropyl)sulfanyl-4-hydroperoxybutanoic acid.
| Compound Name | 3-(2,2-dimethyl-3-naphthalen-2-yloxy-3-oxopropyl)sulfanyl-4-hydroperoxybutanoic acid |
|---|---|
| PubChem CID | 168836459 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-(2,2-dimethyl-3-naphthalen-2-yloxy-3-oxopropyl)sulfanyl-4-hydroperoxybutanoic acid |
| SMILES | CC(C)(CSC(COO)CC(=O)O)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H22O6S/c1-19(2,12-26-16(11-24-23)10-17(20)21)18(22)25-15-8-7-13-5-3-4-6-14(13)9-15/h3-9,16,23H,10-12H2,1-2H3,(H,20,21) |
| InChIKey | DXPBYXYJHLJBDT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|