C29H39F3O6 — CID 134460793
3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-phenyl 5-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 134460793) has the molecular formula C29H39F3O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-phenyl 5-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-phenyl 5-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134460793 |
| Molecular Formula | C29H39F3O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-phenyl 5-O-(1,1,1-trifluoropropan-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(OC(=O)C(C)(C)CC(C)(CC(C)(C)C(=O)Oc1ccccc1)C(=O)OC1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C29H39F3O6/c1-18(29(30,31)32)36-23(33)26(2,3)16-28(6,25(35)38-22-15-19-12-13-20(22)14-19)17-27(4,5)24(34)37-21-10-8-7-9-11-21/h7-11,18-20,22H,12-17H2,1-6H3 |
| InChIKey | CCNOTUIYYJFMGQ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|