C45H46F6O7 — CID 134461962
3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-[7-(naphthalene-2-carbonyl)naphthalen-2-yl] 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 134461962) has the molecular formula C45H46F6O7 and a molecular weight of 812.84 g/mol. Its IUPAC name is 3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-[7-(naphthalene-2-carbonyl)naphthalen-2-yl] 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-[7-(naphthalene-2-carbonyl)naphthalen-2-yl] 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134461962 |
| Molecular Formula | C45H46F6O7 |
| Molecular Weight | 812.84 g/mol |
| Exact Mass | 812.31 |
| IUPAC Name | 3-O-(2-bicyclo[2.2.1]heptanyl) 1-O-[7-(naphthalene-2-carbonyl)naphthalen-2-yl] 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(C)(CC(C)(CC(C)(C)C(=O)Oc1ccc2ccc(C(=O)c3ccc4ccccc4c3)cc2c1)C(=O)OC1CC2CCC1C2)C(=O)OCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C45H46F6O7/c1-41(2,38(53)56-23-36(44(46,47)48)45(49,50)51)24-43(5,40(55)58-35-19-26-10-11-30(35)18-26)25-42(3,4)39(54)57-34-17-16-28-13-15-32(21-33(28)22-34)37(52)31-14-12-27-8-6-7-9-29(27)20-31/h6-9,12-17,20-22,26,30,35-36H,10-11,18-19,23-25H2,1-5H3 |
| InChIKey | HKGVCDAHRCTMMU-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.84 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|