C21H25NO2 — CID 99131335
(2S)-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 99131335) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S)-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2S)-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 99131335 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2S)-N-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@H](Oc1ccc2ccccc2c1)C(=O)N[C@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C21H25NO2/c1-2-20(21(23)22-19-12-14-7-8-17(19)11-14)24-18-10-9-15-5-3-4-6-16(15)13-18/h3-6,9-10,13-14,17,19-20H,2,7-8,11-12H2,1H3,(H,22,23)/t14-,17-,19+,20+/m1/s1 |
| InChIKey | CTZNUJIBAUPQPV-JBCDFXQESA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |