C17H22FNO2 — CID 99131296
(2R)-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 99131296) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is (2R)-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2R)-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 99131296 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (2R)-N-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@@H](Oc1ccc(F)cc1)C(=O)N[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C17H22FNO2/c1-2-16(21-14-7-5-13(18)6-8-14)17(20)19-15-10-11-3-4-12(15)9-11/h5-8,11-12,15-16H,2-4,9-10H2,1H3,(H,19,20)/t11-,12-,15-,16-/m1/s1 |
| InChIKey | PUBWJRVTOCRVOT-CZPYZCIJSA-N |
| XLogP | 3.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |