C14H18FNO4S — CID 35181634
(2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-fluorophenoxy)butanamide (PubChem CID 35181634) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 35181634 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2S)-N-[(3S)-1,1-dioxothiolan-3-yl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H18FNO4S/c1-2-13(20-12-5-3-10(15)4-6-12)14(17)16-11-7-8-21(18,19)9-11/h3-6,11,13H,2,7-9H2,1H3,(H,16,17)/t11-,13-/m0/s1 |
| InChIKey | LEOWBNOZDFTSRB-AAEUAGOBSA-N |
| XLogP | 1.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |