C35H39F3O6 — CID 134460769
1-O-anthracen-2-yl 3-O-(2-bicyclo[2.2.1]heptanyl) 5-O-(trifluoromethyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 134460769) has the molecular formula C35H39F3O6 and a molecular weight of 612.69 g/mol. Its IUPAC name is 1-O-anthracen-2-yl 3-O-(2-bicyclo[2.2.1]heptanyl) 5-O-(trifluoromethyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 1-O-anthracen-2-yl 3-O-(2-bicyclo[2.2.1]heptanyl) 5-O-(trifluoromethyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134460769 |
| Molecular Formula | C35H39F3O6 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | 1-O-anthracen-2-yl 3-O-(2-bicyclo[2.2.1]heptanyl) 5-O-(trifluoromethyl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(C)(CC(C)(CC(C)(C)C(=O)OC(F)(F)F)C(=O)OC1CC2CCC1C2)C(=O)Oc1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C35H39F3O6/c1-32(2,29(39)42-27-13-12-24-16-22-8-6-7-9-23(22)17-26(24)18-27)19-34(5,20-33(3,4)30(40)44-35(36,37)38)31(41)43-28-15-21-10-11-25(28)14-21/h6-9,12-13,16-18,21,25,28H,10-11,14-15,19-20H2,1-5H3 |
| InChIKey | FFABZRMKPNSJJB-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|