C49H56F6O6 — CID 134461971
1-O-anthracen-2-yl 3-O-(3-hexacyclo[6.6.2.11,4.18,11.05,15.012,16]octadecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 134461971) has the molecular formula C49H56F6O6 and a molecular weight of 854.97 g/mol. Its IUPAC name is 1-O-anthracen-2-yl 3-O-(3-hexacyclo[6.6.2.11,4.18,11.05,15.012,16]octadecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 1-O-anthracen-2-yl 3-O-(3-hexacyclo[6.6.2.11,4.18,11.05,15.012,16]octadecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134461971 |
| Molecular Formula | C49H56F6O6 |
| Molecular Weight | 854.97 g/mol |
| Exact Mass | 854.40 |
| IUPAC Name | 1-O-anthracen-2-yl 3-O-(3-hexacyclo[6.6.2.11,4.18,11.05,15.012,16]octadecanyl) 5-O-[3,3,3-trifluoro-2-(trifluoromethyl)propyl] 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(C)(CC(C)(CC(C)(C)C(=O)Oc1ccc2cc3ccccc3cc2c1)C(=O)OC1CC23CCC4C5CCC6(CCC(C1C2)C3C46)C5)C(=O)OCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C49H56F6O6/c1-43(2,40(56)59-24-37(48(50,51)52)49(53,54)55)25-45(5,26-44(3,4)41(57)60-32-11-10-29-18-27-8-6-7-9-28(27)19-31(29)20-32)42(58)61-36-23-47-17-13-33-30-12-15-46(21-30)16-14-34(35(36)22-47)39(47)38(33)46/h6-11,18-20,30,33-39H,12-17,21-26H2,1-5H3 |
| InChIKey | LEZIYTYNOJBEFH-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.97 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|