C33H46O8 — CID 58817084
3-O-methyl 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate (PubChem CID 58817084) has the molecular formula C33H46O8 and a molecular weight of 570.72 g/mol. Its IUPAC name is 3-O-methyl 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-methyl 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58817084 |
| Molecular Formula | C33H46O8 |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 3-O-methyl 5-O-(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 1-O-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl) 1,1-dimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(CC(C)(C)C(=O)OC1CC2CC1C1C3CCC(C3)C21)C(=O)OC)C(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C33H46O8/c1-5-15(30(35)40-27-19-11-21-22(12-19)31(36)41-28(21)27)8-20(29(34)38-4)14-33(2,3)32(37)39-24-13-18-10-23(24)26-17-7-6-16(9-17)25(18)26/h15-28H,5-14H2,1-4H3 |
| InChIKey | DZQLZMIQUAYAKT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|