C27H38O4S — CID 171430409
(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 4-[4-(butylsulfanylmethyl)phenyl]-2,2-dimethylhexanoate (PubChem CID 171430409) has the molecular formula C27H38O4S and a molecular weight of 458.66 g/mol. Its IUPAC name is (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 4-[4-(butylsulfanylmethyl)phenyl]-2,2-dimethylhexanoate.
| Compound Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 4-[4-(butylsulfanylmethyl)phenyl]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 171430409 |
| Molecular Formula | C27H38O4S |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 4-[4-(butylsulfanylmethyl)phenyl]-2,2-dimethylhexanoate |
| SMILES | CCCCSCc1ccc(C(CC)CC(C)(C)C(=O)OC2C3CC4C(=O)OC2C4C3)cc1 |
| InChI | InChI=1S/C27H38O4S/c1-5-7-12-32-16-17-8-10-19(11-9-17)18(6-2)15-27(3,4)26(29)31-23-20-13-21-22(14-20)25(28)30-24(21)23/h8-11,18,20-24H,5-7,12-16H2,1-4H3 |
| InChIKey | FZMWROKVPLBEPY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|