C28H42O7 — CID 160786180
tert-butyl 2-methylpropanoate;4-ethylphenol;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate (PubChem CID 160786180) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is tert-butyl 2-methylpropanoate;4-ethylphenol;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate.
| Compound Name | tert-butyl 2-methylpropanoate;4-ethylphenol;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 160786180 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | tert-butyl 2-methylpropanoate;4-ethylphenol;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC(C)(C)C.CC(C)C(=O)OC1C2CC3C(=O)OC1C3C2.CCc1ccc(O)cc1 |
| InChI | InChI=1S/C12H16O4.C8H16O2.C8H10O/c1-5(2)11(13)15-9-6-3-7-8(4-6)12(14)16-10(7)9;1-6(2)7(9)10-8(3,4)5;1-2-7-3-5-8(9)6-4-7/h5-10H,3-4H2,1-2H3;6H,1-5H3;3-6,9H,2H2,1H3 |
| InChIKey | SBFUFWOPXVHGJR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|