C25H34O6 — CID 160626347
tert-butyl 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate (PubChem CID 160626347) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is tert-butyl 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate.
| Compound Name | tert-butyl 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 160626347 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | tert-butyl 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1C2CC3C(=O)OC1C3C2.CCc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18O2.C12H16O4/c1-5-10-6-8-11(9-7-10)12(14)15-13(2,3)4;1-5(2)11(13)15-9-6-3-7-8(4-6)12(14)16-10(7)9/h6-9H,5H2,1-4H3;5-10H,3-4H2,1-2H3 |
| InChIKey | RHIRSQITZYHQPT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|