C37H48O9 — CID 159118518
(4-hydroxyphenyl) 2-methylpropanoate;(1-methylcyclopentyl) 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate (PubChem CID 159118518) has the molecular formula C37H48O9 and a molecular weight of 636.78 g/mol. Its IUPAC name is (4-hydroxyphenyl) 2-methylpropanoate;(1-methylcyclopentyl) 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate.
| Compound Name | (4-hydroxyphenyl) 2-methylpropanoate;(1-methylcyclopentyl) 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 159118518 |
| Molecular Formula | C37H48O9 |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | (4-hydroxyphenyl) 2-methylpropanoate;(1-methylcyclopentyl) 4-ethylbenzoate;(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1C2CC3C(=O)OC1C3C2.CC(C)C(=O)Oc1ccc(O)cc1.CCc1ccc(C(=O)OC2(C)CCCC2)cc1 |
| InChI | InChI=1S/C15H20O2.C12H16O4.C10H12O3/c1-3-12-6-8-13(9-7-12)14(16)17-15(2)10-4-5-11-15;1-5(2)11(13)15-9-6-3-7-8(4-6)12(14)16-10(7)9;1-7(2)10(12)13-9-5-3-8(11)4-6-9/h6-9H,3-5,10-11H2,1-2H3;5-10H,3-4H2,1-2H3;3-7,11H,1-2H3 |
| InChIKey | KFJTUHDECUAQGX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|