C21H22N6O4 — CID 91043743
benzyl N-[1-[8-(azidomethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]indazol-1-yl]propan-2-yl]carbamate (PubChem CID 91043743) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is benzyl N-[1-[8-(azidomethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]indazol-1-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[8-(azidomethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]indazol-1-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 91043743 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | benzyl N-[1-[8-(azidomethyl)-7,8-dihydro-[1,4]dioxino[2,3-g]indazol-1-yl]propan-2-yl]carbamate |
| SMILES | CC(Cn1ncc2ccc3c(c21)OC(CN=[N+]=[N-])CO3)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22N6O4/c1-14(25-21(28)30-12-15-5-3-2-4-6-15)11-27-19-16(9-24-27)7-8-18-20(19)31-17(13-29-18)10-23-26-22/h2-9,14,17H,10-13H2,1H3,(H,25,28) |
| InChIKey | SGLZUKWDSACBNI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|