C11H12N2O — CID 91045050
6-(pyridin-2-ylmethyl)-3,5-dihydro-2H-pyridin-4-one (PubChem CID 91045050) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-(pyridin-2-ylmethyl)-3,5-dihydro-2H-pyridin-4-one.
| Compound Name | 6-(pyridin-2-ylmethyl)-3,5-dihydro-2H-pyridin-4-one |
|---|---|
| PubChem CID | 91045050 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-(pyridin-2-ylmethyl)-3,5-dihydro-2H-pyridin-4-one |
| SMILES | O=C1CCN=C(Cc2ccccn2)C1 |
| InChI | InChI=1S/C11H12N2O/c14-11-4-6-13-10(8-11)7-9-3-1-2-5-12-9/h1-3,5H,4,6-8H2 |
| InChIKey | OPANXTHFCZEEHL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |