C26H28ClN3O3S — CID 91046890
(3S,5S)-5-[(3-chlorophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide (PubChem CID 91046890) has the molecular formula C26H28ClN3O3S and a molecular weight of 498.05 g/mol. Its IUPAC name is (3S,5S)-5-[(3-chlorophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide.
| Compound Name | (3S,5S)-5-[(3-chlorophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 91046890 |
| Molecular Formula | C26H28ClN3O3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | (3S,5S)-5-[(3-chlorophenyl)sulfonylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)[C@@H]1CNC[C@@H](NS(=O)(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C26H28ClN3O3S/c27-22-12-7-13-24(15-22)34(32,33)30-23-14-21(16-28-17-23)26(31)29-18-25(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-13,15,21,23,25,28,30H,14,16-18H2,(H,29,31)/t21-,23-/m0/s1 |
| InChIKey | GKWSDQOBXBXLIG-GMAHTHKFSA-N |
| XLogP | 3.54 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |