C27H30ClN3O — CID 73211705
5-[(3-chlorophenyl)methylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide (PubChem CID 73211705) has the molecular formula C27H30ClN3O and a molecular weight of 448.01 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 73211705 |
| Molecular Formula | C27H30ClN3O |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 5-[(3-chlorophenyl)methylamino]-N-(2,2-diphenylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)C1CNCC(NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C27H30ClN3O/c28-24-13-7-8-20(14-24)16-30-25-15-23(17-29-18-25)27(32)31-19-26(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-14,23,25-26,29-30H,15-19H2,(H,31,32) |
| InChIKey | ZLZVXXLSVVORPS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |