C32H33N3O2S — CID 143390445
N-(2,2-diphenylethyl)-5-[(4-phenoxyphenyl)sulfanylamino]piperidine-3-carboxamide (PubChem CID 143390445) has the molecular formula C32H33N3O2S and a molecular weight of 523.70 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-5-[(4-phenoxyphenyl)sulfanylamino]piperidine-3-carboxamide.
| Compound Name | N-(2,2-diphenylethyl)-5-[(4-phenoxyphenyl)sulfanylamino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 143390445 |
| Molecular Formula | C32H33N3O2S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-(2,2-diphenylethyl)-5-[(4-phenoxyphenyl)sulfanylamino]piperidine-3-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)C1CNCC(NSc2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C32H33N3O2S/c36-32(34-23-31(24-10-4-1-5-11-24)25-12-6-2-7-13-25)26-20-27(22-33-21-26)35-38-30-18-16-29(17-19-30)37-28-14-8-3-9-15-28/h1-19,26-27,31,33,35H,20-23H2,(H,34,36) |
| InChIKey | IVDOXXOZCIIENS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|