C23H24O3 — CID 91047255
1,2-dimethoxy-3-(2-methoxyphenyl)-4-(1-phenylethyl)benzene (PubChem CID 91047255) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1,2-dimethoxy-3-(2-methoxyphenyl)-4-(1-phenylethyl)benzene.
| Compound Name | 1,2-dimethoxy-3-(2-methoxyphenyl)-4-(1-phenylethyl)benzene |
|---|---|
| PubChem CID | 91047255 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1,2-dimethoxy-3-(2-methoxyphenyl)-4-(1-phenylethyl)benzene |
| SMILES | COc1ccccc1-c1c(C(C)c2ccccc2)ccc(OC)c1OC |
| InChI | InChI=1S/C23H24O3/c1-16(17-10-6-5-7-11-17)18-14-15-21(25-3)23(26-4)22(18)19-12-8-9-13-20(19)24-2/h5-16H,1-4H3 |
| InChIKey | PZBMCMDNEAGFKU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |