C20H34N2O — CID 91049837
4-(2-benzyl-1,4-oxazepan-4-yl)-2,2,3,3-tetramethylbutan-1-amine (PubChem CID 91049837) has the molecular formula C20H34N2O and a molecular weight of 318.50 g/mol. Its IUPAC name is 4-(2-benzyl-1,4-oxazepan-4-yl)-2,2,3,3-tetramethylbutan-1-amine.
| Compound Name | 4-(2-benzyl-1,4-oxazepan-4-yl)-2,2,3,3-tetramethylbutan-1-amine |
|---|---|
| PubChem CID | 91049837 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 4-(2-benzyl-1,4-oxazepan-4-yl)-2,2,3,3-tetramethylbutan-1-amine |
| SMILES | CC(C)(CN)C(C)(C)CN1CCCOC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H34N2O/c1-19(2,15-21)20(3,4)16-22-11-8-12-23-18(14-22)13-17-9-6-5-7-10-17/h5-7,9-10,18H,8,11-16,21H2,1-4H3 |
| InChIKey | XIGXVCHAMPMRFR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |