C16H25NO5S — CID 91051240
ethyl 2,4,6-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzenesulfonate (PubChem CID 91051240) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is ethyl 2,4,6-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzenesulfonate.
| Compound Name | ethyl 2,4,6-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzenesulfonate |
|---|---|
| PubChem CID | 91051240 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | ethyl 2,4,6-trimethyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzenesulfonate |
| SMILES | CCOS(=O)(=O)c1c(C)cc(C)c(NC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C16H25NO5S/c1-8-21-23(19,20)14-11(3)9-10(2)13(12(14)4)17-15(18)22-16(5,6)7/h9H,8H2,1-7H3,(H,17,18) |
| InChIKey | OIGFSJFTWLQPQU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|