C25H36N2O6 — CID 87634757
tert-butyl N-(4-hydroxyphenyl)carbamate;tert-butyl N-(4-hydroxy-2,3,6-trimethylphenyl)carbamate (PubChem CID 87634757) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is tert-butyl N-(4-hydroxyphenyl)carbamate;tert-butyl N-(4-hydroxy-2,3,6-trimethylphenyl)carbamate.
| Compound Name | tert-butyl N-(4-hydroxyphenyl)carbamate;tert-butyl N-(4-hydroxy-2,3,6-trimethylphenyl)carbamate |
|---|---|
| PubChem CID | 87634757 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | tert-butyl N-(4-hydroxyphenyl)carbamate;tert-butyl N-(4-hydroxy-2,3,6-trimethylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(O)cc1.Cc1cc(O)c(C)c(C)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21NO3.C11H15NO3/c1-8-7-11(16)9(2)10(3)12(8)15-13(17)18-14(4,5)6;1-11(2,3)15-10(14)12-8-4-6-9(13)7-5-8/h7,16H,1-6H3,(H,15,17);4-7,13H,1-3H3,(H,12,14) |
| InChIKey | IPOJMVHJGDHUFC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|