About (2-bromophenyl)phosphane;ethane
(2-bromophenyl)phosphane;ethane (PubChem CID 91051299) has the molecular formula C8H12BrP
and a molecular weight of 219.06 g/mol. Its IUPAC name is (2-bromophenyl)phosphane;ethane.
Molecular Properties
| Compound Name | (2-bromophenyl)phosphane;ethane |
| PubChem CID | 91051299 |
| Molecular Formula | C8H12BrP |
| Molecular Weight | 219.06 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | (2-bromophenyl)phosphane;ethane |
| SMILES | CC.Pc1ccccc1Br |
| InChI | InChI=1S/C6H6BrP.C2H6/c7-5-3-1-2-4-6(5)8;1-2/h1-4H,8H2;1-2H3 |
| InChIKey | SOZHGVYOLXWSCF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.06 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)phosphane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)phosphane;ethane?
The IUPAC name of (2-bromophenyl)phosphane;ethane (CID 91051299) is (2-bromophenyl)phosphane;ethane.
What is the SMILES notation for (2-bromophenyl)phosphane;ethane?
The canonical SMILES for (2-bromophenyl)phosphane;ethane is CC.Pc1ccccc1Br.
What is the InChIKey of (2-bromophenyl)phosphane;ethane?
The InChIKey is SOZHGVYOLXWSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrP.C2H6/c7-5-3-1-2-4-6(5)8;1-2/h1-4H,8H2;1-2H3.
What are the key properties of (2-bromophenyl)phosphane;ethane?
(2-bromophenyl)phosphane;ethane has a molecular weight of 219.06 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)phosphane;ethane is sourced from PubChem (CID 91051299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).