C20H30O5 — CID 91051958
(18R)-12,18-dihydroxy-5-oxoicosa-2,6,8,10-tetraenoic acid (PubChem CID 91051958) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (18R)-12,18-dihydroxy-5-oxoicosa-2,6,8,10-tetraenoic acid.
| Compound Name | (18R)-12,18-dihydroxy-5-oxoicosa-2,6,8,10-tetraenoic acid |
|---|---|
| PubChem CID | 91051958 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (18R)-12,18-dihydroxy-5-oxoicosa-2,6,8,10-tetraenoic acid |
| SMILES | CC[C@@H](O)CCCCCC(O)C=CC=CC=CC(=O)CC=CC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25/h3-4,6-7,10,12-13,16-18,21-22H,2,5,8-9,11,14-15H2,1H3,(H,24,25)/t17-,18?/m1/s1 |
| InChIKey | RHBANAYTZCERON-QNSVNVJESA-N |
| XLogP | 3.34 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|