C33H33FO7S — CID 91052192
2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-3-hydroxyphenoxy]propoxy]-2-propylphenyl]sulfonylbenzoic acid (PubChem CID 91052192) has the molecular formula C33H33FO7S and a molecular weight of 592.69 g/mol. Its IUPAC name is 2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-3-hydroxyphenoxy]propoxy]-2-propylphenyl]sulfonylbenzoic acid.
| Compound Name | 2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-3-hydroxyphenoxy]propoxy]-2-propylphenyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 91052192 |
| Molecular Formula | C33H33FO7S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 2-[3-[3-[2-ethyl-4-(4-fluorophenyl)-3-hydroxyphenoxy]propoxy]-2-propylphenyl]sulfonylbenzoic acid |
| SMILES | CCCc1c(OCCCOc2ccc(-c3ccc(F)cc3)c(O)c2CC)cccc1S(=O)(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C33H33FO7S/c1-3-9-26-28(11-7-13-30(26)42(38,39)31-12-6-5-10-27(31)33(36)37)40-20-8-21-41-29-19-18-25(32(35)24(29)4-2)22-14-16-23(34)17-15-22/h5-7,10-19,35H,3-4,8-9,20-21H2,1-2H3,(H,36,37) |
| InChIKey | UIMWZMUMJSZKCY-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|