C35H43NO6 — CID 91053249
4-[3-[6-[3-ethoxy-5-(1H-indol-6-yl)phenoxy]hexyl]-2-(3-hydroxypropyl)phenoxy]butanoic acid (PubChem CID 91053249) has the molecular formula C35H43NO6 and a molecular weight of 573.73 g/mol. Its IUPAC name is 4-[3-[6-[3-ethoxy-5-(1H-indol-6-yl)phenoxy]hexyl]-2-(3-hydroxypropyl)phenoxy]butanoic acid.
| Compound Name | 4-[3-[6-[3-ethoxy-5-(1H-indol-6-yl)phenoxy]hexyl]-2-(3-hydroxypropyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 91053249 |
| Molecular Formula | C35H43NO6 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 4-[3-[6-[3-ethoxy-5-(1H-indol-6-yl)phenoxy]hexyl]-2-(3-hydroxypropyl)phenoxy]butanoic acid |
| SMILES | CCOc1cc(OCCCCCCc2cccc(OCCCC(=O)O)c2CCCO)cc(-c2ccc3cc[nH]c3c2)c1 |
| InChI | InChI=1S/C35H43NO6/c1-2-40-30-22-29(28-16-15-27-17-18-36-33(27)24-28)23-31(25-30)41-20-6-4-3-5-10-26-11-7-13-34(32(26)12-8-19-37)42-21-9-14-35(38)39/h7,11,13,15-18,22-25,36-37H,2-6,8-10,12,14,19-21H2,1H3,(H,38,39) |
| InChIKey | WZRJLNZTIFQNJJ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|