C18H14N4O4S — CID 9105431
(4R)-3'-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 9105431) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is (4R)-3'-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4R)-3'-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 9105431 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (4R)-3'-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]spiro[2,3-dihydrochromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1N[C@@]2(CCOc3ccccc32)C(=O)N1Cc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C18H14N4O4S/c23-14-9-11(19-17-21(14)6-8-27-17)10-22-15(24)18(20-16(22)25)5-7-26-13-4-2-1-3-12(13)18/h1-4,6,8-9H,5,7,10H2,(H,20,25)/t18-/m1/s1 |
| InChIKey | NPZXZQNHAVKJIS-GOSISDBHSA-N |
| XLogP | 1.49 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|