C20H22N2O5 — CID 9105468
(2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 9105468) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 9105468 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | Cc1ccc(C)c(COC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-14-3-4-15(2)16(11-14)13-27-20(23)18-12-17(22(24)25)5-6-19(18)21-7-9-26-10-8-21/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | MQYLVAHXZYMMME-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|