C15H21ClN4O — CID 91055598
N-[3-[(2-chloro-5-prop-1-enylpyrimidin-4-yl)amino]propyl]cyclobutanecarboxamide (PubChem CID 91055598) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is N-[3-[(2-chloro-5-prop-1-enylpyrimidin-4-yl)amino]propyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[(2-chloro-5-prop-1-enylpyrimidin-4-yl)amino]propyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 91055598 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[3-[(2-chloro-5-prop-1-enylpyrimidin-4-yl)amino]propyl]cyclobutanecarboxamide |
| SMILES | CC=Cc1cnc(Cl)nc1NCCCNC(=O)C1CCC1 |
| InChI | InChI=1S/C15H21ClN4O/c1-2-5-12-10-19-15(16)20-13(12)17-8-4-9-18-14(21)11-6-3-7-11/h2,5,10-11H,3-4,6-9H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | OEWLPEZWNTWEPU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|