C48H42O6 — CID 91056083
5-[4-oxo-2-(trityloxymethyl)oxolan-3-yl]-4-(trityloxymethyl)oxolan-2-one (PubChem CID 91056083) has the molecular formula C48H42O6 and a molecular weight of 714.86 g/mol. Its IUPAC name is 5-[4-oxo-2-(trityloxymethyl)oxolan-3-yl]-4-(trityloxymethyl)oxolan-2-one.
| Compound Name | 5-[4-oxo-2-(trityloxymethyl)oxolan-3-yl]-4-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 91056083 |
| Molecular Formula | C48H42O6 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | 5-[4-oxo-2-(trityloxymethyl)oxolan-3-yl]-4-(trityloxymethyl)oxolan-2-one |
| SMILES | O=C1CC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(C2C(=O)COC2COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C48H42O6/c49-42-33-51-43(34-53-48(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41)45(42)46-35(31-44(50)54-46)32-52-47(36-19-7-1-8-20-36,37-21-9-2-10-22-37)38-23-11-3-12-24-38/h1-30,35,43,45-46H,31-34H2 |
| InChIKey | MGYIHYLXGGTTCW-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|