C29H43N5O — CID 91056202
6-butyl-3-[4-(diethylamino)-2-methylanilino]-2-pent-1-enyl-5-propyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 91056202) has the molecular formula C29H43N5O and a molecular weight of 477.70 g/mol. Its IUPAC name is 6-butyl-3-[4-(diethylamino)-2-methylanilino]-2-pent-1-enyl-5-propyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 6-butyl-3-[4-(diethylamino)-2-methylanilino]-2-pent-1-enyl-5-propyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 91056202 |
| Molecular Formula | C29H43N5O |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | 6-butyl-3-[4-(diethylamino)-2-methylanilino]-2-pent-1-enyl-5-propyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCC=Cc1[nH]n2c(=O)c(CCCC)c(CCC)nc2c1Nc1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C29H43N5O/c1-7-12-14-17-26-27(30-24-19-18-22(20-21(24)6)33(10-4)11-5)28-31-25(15-9-3)23(16-13-8-2)29(35)34(28)32-26/h14,17-20,30,32H,7-13,15-16H2,1-6H3 |
| InChIKey | VUCDRILNQJUXNI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|