C30H45N5O — CID 123502208
(2E)-5,6-dibutyl-3-[4-(diethylamino)-2-methylphenyl]imino-2-pentylidene-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 123502208) has the molecular formula C30H45N5O and a molecular weight of 491.72 g/mol. Its IUPAC name is (2E)-5,6-dibutyl-3-[4-(diethylamino)-2-methylphenyl]imino-2-pentylidene-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | (2E)-5,6-dibutyl-3-[4-(diethylamino)-2-methylphenyl]imino-2-pentylidene-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 123502208 |
| Molecular Formula | C30H45N5O |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | (2E)-5,6-dibutyl-3-[4-(diethylamino)-2-methylphenyl]imino-2-pentylidene-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CCCC/C=c1/[nH]n2c(=O)c(CCCC)c(CCCC)nc2/c1=N\c1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C30H45N5O/c1-7-12-15-18-27-28(31-25-20-19-23(21-22(25)6)34(10-4)11-5)29-32-26(17-14-9-3)24(16-13-8-2)30(36)35(29)33-27/h18-21,33H,7-17H2,1-6H3/b27-18+,31-28- |
| InChIKey | DKBGBQLOPLFRRE-CZWDYVQBSA-N |
| XLogP | 5.78 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|