C17H26N6S — CID 59443429
4-N,4-N-diethyl-2-methyl-1-N-(3-piperazin-1-yl-1,2,4-thiadiazol-5-yl)benzene-1,4-diamine (PubChem CID 59443429) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-methyl-1-N-(3-piperazin-1-yl-1,2,4-thiadiazol-5-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2-methyl-1-N-(3-piperazin-1-yl-1,2,4-thiadiazol-5-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 59443429 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-N,4-N-diethyl-2-methyl-1-N-(3-piperazin-1-yl-1,2,4-thiadiazol-5-yl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(N3CCNCC3)ns2)c(C)c1 |
| InChI | InChI=1S/C17H26N6S/c1-4-22(5-2)14-6-7-15(13(3)12-14)19-17-20-16(21-24-17)23-10-8-18-9-11-23/h6-7,12,18H,4-5,8-11H2,1-3H3,(H,19,20,21) |
| InChIKey | SHBBSYPZZVRLTG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|