C26H27N2O8- — CID 91057880
N-[(2S)-1-(4-carboxy-2,2-dimethyl-1,3-oxazolidin-3-yl)-4-methoxy-1,4-dioxobutan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate (PubChem CID 91057880) has the molecular formula C26H27N2O8- and a molecular weight of 495.51 g/mol. Its IUPAC name is N-[(2S)-1-(4-carboxy-2,2-dimethyl-1,3-oxazolidin-3-yl)-4-methoxy-1,4-dioxobutan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate.
| Compound Name | N-[(2S)-1-(4-carboxy-2,2-dimethyl-1,3-oxazolidin-3-yl)-4-methoxy-1,4-dioxobutan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate |
|---|---|
| PubChem CID | 91057880 |
| Molecular Formula | C26H27N2O8- |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[(2S)-1-(4-carboxy-2,2-dimethyl-1,3-oxazolidin-3-yl)-4-methoxy-1,4-dioxobutan-2-yl]-1-(9H-fluoren-9-ylmethoxy)methanimidate |
| SMILES | COC(=O)C[C@H](/N=C(\[O-])OCC1c2ccccc2-c2ccccc21)C(=O)N1C(C(=O)O)COC1(C)C |
| InChI | InChI=1S/C26H28N2O8/c1-26(2)28(21(14-36-26)24(31)32)23(30)20(12-22(29)34-3)27-25(33)35-13-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-21H,12-14H2,1-3H3,(H,27,33)(H,31,32)/p-1/t20-,21?/m0/s1 |
| InChIKey | IEEBKHXNQZRIOP-BGERDNNASA-M |
| XLogP | 1.51 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|