C37H34N2O5-2 — CID 59467860
1-(9H-fluoren-9-ylmethoxy)-N-[5-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-6-oxoheptyl]methanimidate (PubChem CID 59467860) has the molecular formula C37H34N2O5-2 and a molecular weight of 586.69 g/mol. Its IUPAC name is 1-(9H-fluoren-9-ylmethoxy)-N-[5-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-6-oxoheptyl]methanimidate.
| Compound Name | 1-(9H-fluoren-9-ylmethoxy)-N-[5-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-6-oxoheptyl]methanimidate |
|---|---|
| PubChem CID | 59467860 |
| Molecular Formula | C37H34N2O5-2 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | 1-(9H-fluoren-9-ylmethoxy)-N-[5-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-6-oxoheptyl]methanimidate |
| SMILES | CC(=O)C(CCCC/N=C(\[O-])OCC1c2ccccc2-c2ccccc21)/N=C(\[O-])OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H36N2O5/c1-24(40)35(39-37(42)44-23-34-31-18-8-4-14-27(31)28-15-5-9-19-32(28)34)20-10-11-21-38-36(41)43-22-33-29-16-6-2-12-25(29)26-13-3-7-17-30(26)33/h2-9,12-19,33-35H,10-11,20-23H2,1H3,(H,38,41)(H,39,42)/p-2 |
| InChIKey | OVDRLOUYOHUQSW-UHFFFAOYSA-L |
| XLogP | 5.21 |
| TPSA | 106.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|