C21H21NNaO3Se — CID 119079653
CID 119079653 (PubChem CID 119079653) has the molecular formula C21H21NNaO3Se and a molecular weight of 437.35 g/mol.
| Compound Name | CID 119079653 |
|---|---|
| PubChem CID | 119079653 |
| Molecular Formula | C21H21NNaO3Se |
| Molecular Weight | 437.35 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | — |
| SMILES | CC[C@@H](C)[C@@H](/N=C(\[O-])OCC1c2ccccc2-c2ccccc21)C(=O)[Se].[Na+] |
| InChI | InChI=1S/C21H22NO3Se.Na/c1-3-13(2)19(20(23)26)22-21(24)25-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18;/h4-11,13,18-19H,3,12H2,1-2H3,(H,22,24);/q;+1/p-1/t13-,19-;/m1./s1 |
| InChIKey | GAVSUGSCXZXFQD-NXDRBNLFSA-M |
| XLogP | -0.35 |
| TPSA | 61.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|