C32H26NNa2O8P — CID 102591455
disodium;(2S)-2-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-3-[4-[hydroxy(phenylmethoxy)phosphoryl]carbonylphenyl]propanoate (PubChem CID 102591455) has the molecular formula C32H26NNa2O8P and a molecular weight of 629.51 g/mol. Its IUPAC name is disodium;(2S)-2-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-3-[4-[hydroxy(phenylmethoxy)phosphoryl]carbonylphenyl]propanoate.
| Compound Name | disodium;(2S)-2-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-3-[4-[hydroxy(phenylmethoxy)phosphoryl]carbonylphenyl]propanoate |
|---|---|
| PubChem CID | 102591455 |
| Molecular Formula | C32H26NNa2O8P |
| Molecular Weight | 629.51 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | disodium;(2S)-2-[[9H-fluoren-9-ylmethoxy(oxido)methylidene]amino]-3-[4-[hydroxy(phenylmethoxy)phosphoryl]carbonylphenyl]propanoate |
| SMILES | O=C([O-])[C@H](Cc1ccc(C(=O)P(=O)(O)OCc2ccccc2)cc1)/N=C(\[O-])OCC1c2ccccc2-c2ccccc21.[Na+].[Na+] |
| InChI | InChI=1S/C32H28NO8P.2Na/c34-30(35)29(33-32(37)40-20-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28)18-21-14-16-23(17-15-21)31(36)42(38,39)41-19-22-8-2-1-3-9-22;;/h1-17,28-29H,18-20H2,(H,33,37)(H,34,35)(H,38,39);;/q;2*+1/p-2/t29-;;/m0../s1 |
| InChIKey | OVQXQYLVPVRMOC-UJXPALLWSA-L |
| XLogP | -2.56 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.51 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|