C24H20NO6P — CID 175830233
[(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]imino-(9H-fluoren-9-ylmethoxycarbonyl)-oxidophosphanium (PubChem CID 175830233) has the molecular formula C24H20NO6P and a molecular weight of 449.40 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]imino-(9H-fluoren-9-ylmethoxycarbonyl)-oxidophosphanium.
| Compound Name | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]imino-(9H-fluoren-9-ylmethoxycarbonyl)-oxidophosphanium |
|---|---|
| PubChem CID | 175830233 |
| Molecular Formula | C24H20NO6P |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [(1S)-1-carboxy-2-(4-hydroxyphenyl)ethyl]imino-(9H-fluoren-9-ylmethoxycarbonyl)-oxidophosphanium |
| SMILES | O=C(O)[C@H](Cc1ccc(O)cc1)/N=[P+](\[O-])C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H20NO6P/c26-16-11-9-15(10-12-16)13-22(23(27)28)25-32(30)24(29)31-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22,26H,13-14H2,(H,27,28)/t22-/m0/s1 |
| InChIKey | SBOXCJSXZNSSCE-QFIPXVFZSA-N |
| XLogP | 4.28 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|