C15H28N2O3 — CID 91058905
ethyl (4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate (PubChem CID 91058905) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is ethyl (4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate.
| Compound Name | ethyl (4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 91058905 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | ethyl (4S)-4-[[(2S)-2-amino-3,3-dimethylbutanoyl]-methylamino]-2-methylpent-2-enoate |
| SMILES | CCOC(=O)C(C)=C[C@H](C)N(C)C(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C15H28N2O3/c1-8-20-14(19)10(2)9-11(3)17(7)13(18)12(16)15(4,5)6/h9,11-12H,8,16H2,1-7H3/t11-,12+/m0/s1 |
| InChIKey | PIGXKLKSZFMCBN-NWDGAFQWSA-N |
| XLogP | 1.72 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|