C19H22N2S — CID 91060176
1-(4-pyridin-4-ylsulfanylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 91060176) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 1-(4-pyridin-4-ylsulfanylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 1-(4-pyridin-4-ylsulfanylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 91060176 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(4-pyridin-4-ylsulfanylphenyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | c1cc(Sc2ccc(C3CCN4CCCCC34)cc2)ccn1 |
| InChI | InChI=1S/C19H22N2S/c1-2-13-21-14-10-18(19(21)3-1)15-4-6-16(7-5-15)22-17-8-11-20-12-9-17/h4-9,11-12,18-19H,1-3,10,13-14H2 |
| InChIKey | UYHAKZDYJSPMAT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |