C10H21NO5 — CID 91060527
2-(1,3-dihydroxypropan-2-yloxy)ethyl N-tert-butylcarbamate (PubChem CID 91060527) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(1,3-dihydroxypropan-2-yloxy)ethyl N-tert-butylcarbamate.
| Compound Name | 2-(1,3-dihydroxypropan-2-yloxy)ethyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91060527 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(1,3-dihydroxypropan-2-yloxy)ethyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCOC(CO)CO |
| InChI | InChI=1S/C10H21NO5/c1-10(2,3)11-9(14)16-5-4-15-8(6-12)7-13/h8,12-13H,4-7H2,1-3H3,(H,11,14) |
| InChIKey | JJALQVKCBHPWPA-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|