C19H16F3N3O3S — CID 91062669
N-[3-[4-methoxy-3-(trifluoromethyl)phenyl]propanoyl]-1,3-benzothiazole-6-carbohydrazide (PubChem CID 91062669) has the molecular formula C19H16F3N3O3S and a molecular weight of 423.42 g/mol. Its IUPAC name is N-[3-[4-methoxy-3-(trifluoromethyl)phenyl]propanoyl]-1,3-benzothiazole-6-carbohydrazide.
| Compound Name | N-[3-[4-methoxy-3-(trifluoromethyl)phenyl]propanoyl]-1,3-benzothiazole-6-carbohydrazide |
|---|---|
| PubChem CID | 91062669 |
| Molecular Formula | C19H16F3N3O3S |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[3-[4-methoxy-3-(trifluoromethyl)phenyl]propanoyl]-1,3-benzothiazole-6-carbohydrazide |
| SMILES | COc1ccc(CCC(=O)N(N)C(=O)c2ccc3ncsc3c2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O3S/c1-28-15-6-2-11(8-13(15)19(20,21)22)3-7-17(26)25(23)18(27)12-4-5-14-16(9-12)29-10-24-14/h2,4-6,8-10H,3,7,23H2,1H3 |
| InChIKey | DRNBRVFFPWYALM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|